What is the 4-(2,3-DIMETHYL-BENZYL)-1H-IMIDAZOLE?

4-(2,3-DIMETHYL-BENZYL)-1H-IMIDAZOLE is White crystalline powder, while it's Molecular Formula is C 12 H 14 N 2 . White crystalline powder Detomidine is a α-Adrenoceptor agonist with sedative and analgesic activity. Sedative.

What is the CAS number for 4-(2,3-DIMETHYL-BENZYL)-1H-IMIDAZOLE?

The CAS number of 4-(2,3-DIMETHYL-BENZYL)-1H-IMIDAZOLE is 76631-46-4.

What is 4-(2,3-DIMETHYL-BENZYL)-1H-IMIDAZOLE (76631-46-4) used for?

4-(2,3-DIMETHYL-BENZYL)-1H-IMIDAZOLE is an organic compound with the molecular formula C14H14N2. It is characterized by its imidazole ring structure, which is fused with a benzene ring, and a dimethyl-substituted benzyl group attached to the imidazole. 4-(2,3-DIMETHYL-BENZYL)-1H-IMIDAZOLE is known for its potential applications in various industries due to its unique chemical properties.InChI:InChI=1/C12H14N2/c1-9-4-3-5-11(10(9)2)6-12-7-13-8-14-12/h3-5,7-8H,6H2,1-2H3,(H,13,14)

What is the 4-(2,3-DIMETHYL-BENZYL)-1H-IMIDAZOLE?

4-(2,3-DIMETHYL-BENZYL)-1H-IMIDAZOLE is White crystalline powder, while it's Molecular Formula is C 12 H 14 N 2 . White crystalline powder Detomidine is a α-Adrenoceptor agonist with sedative and analgesic activity. Sedative.

What is the CAS number for 4-(2,3-DIMETHYL-BENZYL)-1H-IMIDAZOLE?

The CAS number of 4-(2,3-DIMETHYL-BENZYL)-1H-IMIDAZOLE is 76631-46-4.

What is 4-(2,3-DIMETHYL-BENZYL)-1H-IMIDAZOLE (76631-46-4) used for?

4-(2,3-DIMETHYL-BENZYL)-1H-IMIDAZOLE is an organic compound with the molecular formula C14H14N2. It is characterized by its imidazole ring structure, which is fused with a benzene ring, and a dimethyl-substituted benzyl group attached to the imidazole. 4-(2,3-DIMETHYL-BENZYL)-1H-IMIDAZOLE is known for its potential applications in various industries due to its unique chemical properties.InChI:InChI=1/C12H14N2/c1-9-4-3-5-11(10(9)2)6-12-7-13-8-14-12/h3-5,7-8H,6H2,1-2H3,(H,13,14)