What is the Valerophenone?

Valerophenone is colourless liquid, while it's Molecular Formula is C11H14O. colourless liquid Valerophenone is an aromatic ketone that is often used as a tool in the study of various photochemical processes. It is used as intermediates of liquid crystals. It is also an inhibitor of the enzyme carbonyl reductase.

What is the CAS number for Valerophenone?

The CAS number of Valerophenone is 1009-14-9.

What is Valerophenone (1009-14-9) used for?

InChI:InChI=1/C11H14O/c1-2-3-9-11(12)10-7-5-4-6-8-10/h4-8H,2-3,9H2,1H3

What is the Valerophenone?

Valerophenone is colourless liquid, while it's Molecular Formula is C11H14O. colourless liquid Valerophenone is an aromatic ketone that is often used as a tool in the study of various photochemical processes. It is used as intermediates of liquid crystals. It is also an inhibitor of the enzyme carbonyl reductase.